About 2-butyl-1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxamide
2-butyl-1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxamide (PubChem CID 67033847) has the molecular formula C17H22Cl2N4O
and a molecular weight of 369.30 g/mol. Its IUPAC name is 2-butyl-1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 2-butyl-1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxamide |
| PubChem CID | 67033847 |
| Molecular Formula | C17H22Cl2N4O |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 2-butyl-1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxamide |
| SMILES | CCCCC1CC(C(N)=O)CCN1c1nc2cc(Cl)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C17H22Cl2N4O/c1-2-3-4-11-7-10(16(20)24)5-6-23(11)17-21-14-8-12(18)13(19)9-15(14)22-17/h8-11H,2-7H2,1H3,(H2,20,24)(H,21,22) |
| InChIKey | LEWWTFDKZGUEIC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-butyl-1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxamide?
The IUPAC name of 2-butyl-1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxamide (CID 67033847) is 2-butyl-1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxamide.
What is the SMILES notation for 2-butyl-1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxamide?
The canonical SMILES for 2-butyl-1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxamide is CCCCC1CC(C(N)=O)CCN1c1nc2cc(Cl)c(Cl)cc2[nH]1.
What is the InChIKey of 2-butyl-1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxamide?
The InChIKey is LEWWTFDKZGUEIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22Cl2N4O/c1-2-3-4-11-7-10(16(20)24)5-6-23(11)17-21-14-8-12(18)13(19)9-15(14)22-17/h8-11H,2-7H2,1H3,(H2,20,24)(H,21,22).
What are the key properties of 2-butyl-1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxamide?
2-butyl-1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxamide has a molecular weight of 369.30 g/mol, XLogP of 4.13, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxamide is sourced from PubChem (CID 67033847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).