C17H22Cl2N4O — CID 67033847
2-butyl-1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxamide (PubChem CID 67033847) has the molecular formula C17H22Cl2N4O and a molecular weight of 369.30 g/mol. Its IUPAC name is 2-butyl-1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxamide.
| Compound Name | 2-butyl-1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 67033847 |
| Molecular Formula | C17H22Cl2N4O |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 2-butyl-1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxamide |
| SMILES | CCCCC1CC(C(N)=O)CCN1c1nc2cc(Cl)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C17H22Cl2N4O/c1-2-3-4-11-7-10(16(20)24)5-6-23(11)17-21-14-8-12(18)13(19)9-15(14)22-17/h8-11H,2-7H2,1H3,(H2,20,24)(H,21,22) |
| InChIKey | LEWWTFDKZGUEIC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |