C22H25ClN4O — CID 46359077
1-(6-chloro-1H-benzimidazol-2-yl)-N-[(4-ethylphenyl)methyl]piperidine-4-carboxamide (PubChem CID 46359077) has the molecular formula C22H25ClN4O and a molecular weight of 396.92 g/mol. Its IUPAC name is 1-(6-chloro-1H-benzimidazol-2-yl)-N-[(4-ethylphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-(6-chloro-1H-benzimidazol-2-yl)-N-[(4-ethylphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46359077 |
| Molecular Formula | C22H25ClN4O |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 1-(6-chloro-1H-benzimidazol-2-yl)-N-[(4-ethylphenyl)methyl]piperidine-4-carboxamide |
| SMILES | CCc1ccc(CNC(=O)C2CCN(c3nc4ccc(Cl)cc4[nH]3)CC2)cc1 |
| InChI | InChI=1S/C22H25ClN4O/c1-2-15-3-5-16(6-4-15)14-24-21(28)17-9-11-27(12-10-17)22-25-19-8-7-18(23)13-20(19)26-22/h3-8,13,17H,2,9-12,14H2,1H3,(H,24,28)(H,25,26) |
| InChIKey | CZWVLFNYCJJWQP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |