C23H27ClN4O — CID 46359054
1-(6-chloro-1H-benzimidazol-2-yl)-N-(4-phenylbutan-2-yl)piperidine-4-carboxamide (PubChem CID 46359054) has the molecular formula C23H27ClN4O and a molecular weight of 410.95 g/mol. Its IUPAC name is 1-(6-chloro-1H-benzimidazol-2-yl)-N-(4-phenylbutan-2-yl)piperidine-4-carboxamide.
| Compound Name | 1-(6-chloro-1H-benzimidazol-2-yl)-N-(4-phenylbutan-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46359054 |
| Molecular Formula | C23H27ClN4O |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 1-(6-chloro-1H-benzimidazol-2-yl)-N-(4-phenylbutan-2-yl)piperidine-4-carboxamide |
| SMILES | CC(CCc1ccccc1)NC(=O)C1CCN(c2nc3ccc(Cl)cc3[nH]2)CC1 |
| InChI | InChI=1S/C23H27ClN4O/c1-16(7-8-17-5-3-2-4-6-17)25-22(29)18-11-13-28(14-12-18)23-26-20-10-9-19(24)15-21(20)27-23/h2-6,9-10,15-16,18H,7-8,11-14H2,1H3,(H,25,29)(H,26,27) |
| InChIKey | SVOFPXNAHRFMQZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |