C32H40Cl2N6O4 — CID 70654030
ethyl 1-(5-chloro-6-methyl-1H-benzimidazol-2-yl)piperidine-4-carboxylate (PubChem CID 70654030) has the molecular formula C32H40Cl2N6O4 and a molecular weight of 643.62 g/mol. Its IUPAC name is ethyl 1-(5-chloro-6-methyl-1H-benzimidazol-2-yl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(5-chloro-6-methyl-1H-benzimidazol-2-yl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 70654030 |
| Molecular Formula | C32H40Cl2N6O4 |
| Molecular Weight | 643.62 g/mol |
| Exact Mass | 642.25 |
| IUPAC Name | ethyl 1-(5-chloro-6-methyl-1H-benzimidazol-2-yl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2nc3cc(Cl)c(C)cc3[nH]2)CC1.CCOC(=O)C1CCN(c2nc3cc(Cl)c(C)cc3[nH]2)CC1 |
| InChI | InChI=1S/2C16H20ClN3O2/c2*1-3-22-15(21)11-4-6-20(7-5-11)16-18-13-8-10(2)12(17)9-14(13)19-16/h2*8-9,11H,3-7H2,1-2H3,(H,18,19) |
| InChIKey | IQPXFGDFHHQTPA-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 116.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.62 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |