C22H15ClN3OS2+ — CID 123523866
[4-[[5-[[4-(4-chlorophenyl)thiophen-2-yl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]-methylidyneazanium (PubChem CID 123523866) has the molecular formula C22H15ClN3OS2+ and a molecular weight of 436.97 g/mol. Its IUPAC name is [4-[[5-[[4-(4-chlorophenyl)thiophen-2-yl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]-methylidyneazanium.
| Compound Name | [4-[[5-[[4-(4-chlorophenyl)thiophen-2-yl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]-methylidyneazanium |
|---|---|
| PubChem CID | 123523866 |
| Molecular Formula | C22H15ClN3OS2+ |
| Molecular Weight | 436.97 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | [4-[[5-[[4-(4-chlorophenyl)thiophen-2-yl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]-methylidyneazanium |
| SMILES | C#[N+]c1ccc(/N=C2/SC(=Cc3cc(-c4ccc(Cl)cc4)cs3)C(=O)N2C)cc1 |
| InChI | InChI=1S/C22H15ClN3OS2/c1-24-17-7-9-18(10-8-17)25-22-26(2)21(27)20(29-22)12-19-11-15(13-28-19)14-3-5-16(23)6-4-14/h1,3-13H,2H3/q+1/b20-12?,25-22+ |
| InChIKey | YWVIDGIFSXEWCB-HMLXQPDYSA-N |
| XLogP | 6.90 |
| TPSA | 37.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.97 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|