C18H11Cl2N2O3S- — CID 7323588
3-[[(5E)-5-[(2,4-dichlorophenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 7323588) has the molecular formula C18H11Cl2N2O3S- and a molecular weight of 406.27 g/mol. Its IUPAC name is 3-[[(5E)-5-[(2,4-dichlorophenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | 3-[[(5E)-5-[(2,4-dichlorophenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 7323588 |
| Molecular Formula | C18H11Cl2N2O3S- |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 404.99 |
| IUPAC Name | 3-[[(5E)-5-[(2,4-dichlorophenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CN1C(=O)/C(=C\c2ccc(Cl)cc2Cl)S/C1=N\c1cccc(C(=O)[O-])c1 |
| InChI | InChI=1S/C18H12Cl2N2O3S/c1-22-16(23)15(8-10-5-6-12(19)9-14(10)20)26-18(22)21-13-4-2-3-11(7-13)17(24)25/h2-9H,1H3,(H,24,25)/p-1/b15-8+,21-18- |
| InChIKey | RIICHEVSUBYCMM-NUFACVACSA-M |
| XLogP | 3.59 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|