C18H12ClN2O4S- — CID 54682490
2-[(Z)-[2-(3-carboxyphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-4-chlorophenolate (PubChem CID 54682490) has the molecular formula C18H12ClN2O4S- and a molecular weight of 387.82 g/mol. Its IUPAC name is 2-[(Z)-[2-(3-carboxyphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-4-chlorophenolate.
| Compound Name | 2-[(Z)-[2-(3-carboxyphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-4-chlorophenolate |
|---|---|
| PubChem CID | 54682490 |
| Molecular Formula | C18H12ClN2O4S- |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 2-[(Z)-[2-(3-carboxyphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-4-chlorophenolate |
| SMILES | CN1C(=O)/C(=C/c2cc(Cl)ccc2[O-])S/C1=N/c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C18H13ClN2O4S/c1-21-16(23)15(9-11-7-12(19)5-6-14(11)22)26-18(21)20-13-4-2-3-10(8-13)17(24)25/h2-9,22H,1H3,(H,24,25)/p-1/b15-9-,20-18+ |
| InChIKey | VOQRUGXTUITLKO-LBVWADOBSA-M |
| XLogP | 3.35 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|