C27H47ClN4O — CID 123524456
N-[(2R)-1-[(4R)-4-(4-chlorocyclohexyl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-1,2,4a,5,6,7,8,8a-octahydroquinoxaline-6-carboxamide (PubChem CID 123524456) has the molecular formula C27H47ClN4O and a molecular weight of 479.15 g/mol. Its IUPAC name is N-[(2R)-1-[(4R)-4-(4-chlorocyclohexyl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-1,2,4a,5,6,7,8,8a-octahydroquinoxaline-6-carboxamide.
| Compound Name | N-[(2R)-1-[(4R)-4-(4-chlorocyclohexyl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-1,2,4a,5,6,7,8,8a-octahydroquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 123524456 |
| Molecular Formula | C27H47ClN4O |
| Molecular Weight | 479.15 g/mol |
| Exact Mass | 478.34 |
| IUPAC Name | N-[(2R)-1-[(4R)-4-(4-chlorocyclohexyl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-1,2,4a,5,6,7,8,8a-octahydroquinoxaline-6-carboxamide |
| SMILES | CC(C)[C@H](CN1CC[C@H](C2CCC(Cl)CC2)C(C)(C)C1)NC(=O)C1CCC2NCC=NC2C1 |
| InChI | InChI=1S/C27H47ClN4O/c1-18(2)25(31-26(33)20-7-10-23-24(15-20)30-13-12-29-23)16-32-14-11-22(27(3,4)17-32)19-5-8-21(28)9-6-19/h13,18-25,29H,5-12,14-17H2,1-4H3,(H,31,33)/t19?,20?,21?,22-,23?,24?,25+/m1/s1 |
| InChIKey | PJSVAZBTZLWILB-RXNOZMBBSA-N |
| XLogP | 4.48 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.15 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|