C23H44ClN3O — CID 58457537
N-[(2R)-1-[4-(4-chlorocyclohexyl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-3-(ethylamino)propanamide (PubChem CID 58457537) has the molecular formula C23H44ClN3O and a molecular weight of 414.08 g/mol. Its IUPAC name is N-[(2R)-1-[4-(4-chlorocyclohexyl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-3-(ethylamino)propanamide.
| Compound Name | N-[(2R)-1-[4-(4-chlorocyclohexyl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-3-(ethylamino)propanamide |
|---|---|
| PubChem CID | 58457537 |
| Molecular Formula | C23H44ClN3O |
| Molecular Weight | 414.08 g/mol |
| Exact Mass | 413.32 |
| IUPAC Name | N-[(2R)-1-[4-(4-chlorocyclohexyl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-3-(ethylamino)propanamide |
| SMILES | CCNCCC(=O)N[C@@H](CN1CCC(C2CCC(Cl)CC2)C(C)(C)C1)C(C)C |
| InChI | InChI=1S/C23H44ClN3O/c1-6-25-13-11-22(28)26-21(17(2)3)15-27-14-12-20(23(4,5)16-27)18-7-9-19(24)10-8-18/h17-21,25H,6-16H2,1-5H3,(H,26,28)/t18?,19?,20?,21-/m0/s1 |
| InChIKey | CSJQABAFBWRKIL-FNNAPWSISA-N |
| XLogP | 4.27 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.08 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|