C7H16FNO — CID 123524742
1-ethoxy-3-fluoro-N,N-dimethylpropan-2-amine (PubChem CID 123524742) has the molecular formula C7H16FNO and a molecular weight of 149.21 g/mol. Its IUPAC name is 1-ethoxy-3-fluoro-N,N-dimethylpropan-2-amine.
| Compound Name | 1-ethoxy-3-fluoro-N,N-dimethylpropan-2-amine |
|---|---|
| PubChem CID | 123524742 |
| Molecular Formula | C7H16FNO |
| Molecular Weight | 149.21 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 1-ethoxy-3-fluoro-N,N-dimethylpropan-2-amine |
| SMILES | CCOCC(CF)N(C)C |
| InChI | InChI=1S/C7H16FNO/c1-4-10-6-7(5-8)9(2)3/h7H,4-6H2,1-3H3 |
| InChIKey | NHCSAWMLRRONKA-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.21 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |