C7H17NO — CID 45087490
1-methoxy-N,N-dimethylbutan-2-amine (PubChem CID 45087490) has the molecular formula C7H17NO and a molecular weight of 131.22 g/mol. Its IUPAC name is 1-methoxy-N,N-dimethylbutan-2-amine.
| Compound Name | 1-methoxy-N,N-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 45087490 |
| Molecular Formula | C7H17NO |
| Molecular Weight | 131.22 g/mol |
| Exact Mass | 131.13 |
| IUPAC Name | 1-methoxy-N,N-dimethylbutan-2-amine |
| SMILES | CCC(COC)N(C)C |
| InChI | InChI=1S/C7H17NO/c1-5-7(6-9-4)8(2)3/h7H,5-6H2,1-4H3 |
| InChIKey | YABJQYZJFDJJSK-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.22 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |