C6H8ClN — CID 123525810
(3Z)-5-chlorohexa-3,5-dien-2-imine (PubChem CID 123525810) has the molecular formula C6H8ClN and a molecular weight of 129.59 g/mol. Its IUPAC name is (3Z)-5-chlorohexa-3,5-dien-2-imine.
| Compound Name | (3Z)-5-chlorohexa-3,5-dien-2-imine |
|---|---|
| PubChem CID | 123525810 |
| Molecular Formula | C6H8ClN |
| Molecular Weight | 129.59 g/mol |
| Exact Mass | 129.03 |
| IUPAC Name | (3Z)-5-chlorohexa-3,5-dien-2-imine |
| SMILES | [H]/N=C(C)/C=C\C(=C)Cl |
| InChI | InChI=1S/C6H8ClN/c1-5(7)3-4-6(2)8/h3-4,8H,1H2,2H3/b4-3-,8-6+ |
| InChIKey | LSXFOGWYIKGTIN-OONGGIDMSA-N |
| XLogP | 2.33 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.59 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|