C11H16F3N — CID 123526598
2-[2-(2-methylprop-1-enyl)-3-(2,2,2-trifluoroethyl)cyclopropyl]ethanimine (PubChem CID 123526598) has the molecular formula C11H16F3N and a molecular weight of 219.25 g/mol. Its IUPAC name is 2-[2-(2-methylprop-1-enyl)-3-(2,2,2-trifluoroethyl)cyclopropyl]ethanimine.
| Compound Name | 2-[2-(2-methylprop-1-enyl)-3-(2,2,2-trifluoroethyl)cyclopropyl]ethanimine |
|---|---|
| PubChem CID | 123526598 |
| Molecular Formula | C11H16F3N |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 2-[2-(2-methylprop-1-enyl)-3-(2,2,2-trifluoroethyl)cyclopropyl]ethanimine |
| SMILES | [H]/N=C/CC1C(C=C(C)C)C1CC(F)(F)F |
| InChI | InChI=1S/C11H16F3N/c1-7(2)5-9-8(3-4-15)10(9)6-11(12,13)14/h4-5,8-10,15H,3,6H2,1-2H3/b15-4+ |
| InChIKey | JYAXLFACKKHQBJ-SYZQJQIISA-N |
| XLogP | 3.81 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|