C13H20F3N — CID 123677463
4-methyl-2-[(2-methylcyclopropyl)methylidene]-3-(trifluoromethyl)hexan-1-imine (PubChem CID 123677463) has the molecular formula C13H20F3N and a molecular weight of 247.30 g/mol. Its IUPAC name is 4-methyl-2-[(2-methylcyclopropyl)methylidene]-3-(trifluoromethyl)hexan-1-imine.
| Compound Name | 4-methyl-2-[(2-methylcyclopropyl)methylidene]-3-(trifluoromethyl)hexan-1-imine |
|---|---|
| PubChem CID | 123677463 |
| Molecular Formula | C13H20F3N |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 4-methyl-2-[(2-methylcyclopropyl)methylidene]-3-(trifluoromethyl)hexan-1-imine |
| SMILES | [H]/N=C/C(=CC1CC1C)C(C(C)CC)C(F)(F)F |
| InChI | InChI=1S/C13H20F3N/c1-4-8(2)12(13(14,15)16)11(7-17)6-10-5-9(10)3/h6-10,12,17H,4-5H2,1-3H3/b11-6?,17-7+ |
| InChIKey | UZNMVEZROWEMDV-VTZCNVMRSA-N |
| XLogP | 4.44 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|