C12H15N2+ — CID 123527211
1-(1-azoniacyclohepta-1,3,5,7-tetraen-4-yl)-N,3-dimethylbut-2-en-1-imine (PubChem CID 123527211) has the molecular formula C12H15N2+ and a molecular weight of 187.27 g/mol. Its IUPAC name is 1-(1-azoniacyclohepta-1,3,5,7-tetraen-4-yl)-N,3-dimethylbut-2-en-1-imine.
| Compound Name | 1-(1-azoniacyclohepta-1,3,5,7-tetraen-4-yl)-N,3-dimethylbut-2-en-1-imine |
|---|---|
| PubChem CID | 123527211 |
| Molecular Formula | C12H15N2+ |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 1-(1-azoniacyclohepta-1,3,5,7-tetraen-4-yl)-N,3-dimethylbut-2-en-1-imine |
| SMILES | C/N=C(\C=C(C)C)C1=CC=[N+]=CC=C1 |
| InChI | InChI=1S/C12H15N2/c1-10(2)9-12(13-3)11-5-4-7-14-8-6-11/h4-9H,1-3H3/q+1/b13-12+ |
| InChIKey | MEDMKZLOBXCPRP-OUKQBFOZSA-N |
| XLogP | 1.73 |
| TPSA | 26.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|