C10H11F2N — CID 143794971
1-(2,6-difluorocyclohepta-1,3,6-trien-1-yl)-N-methylethanimine (PubChem CID 143794971) has the molecular formula C10H11F2N and a molecular weight of 183.20 g/mol. Its IUPAC name is 1-(2,6-difluorocyclohepta-1,3,6-trien-1-yl)-N-methylethanimine.
| Compound Name | 1-(2,6-difluorocyclohepta-1,3,6-trien-1-yl)-N-methylethanimine |
|---|---|
| PubChem CID | 143794971 |
| Molecular Formula | C10H11F2N |
| Molecular Weight | 183.20 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 1-(2,6-difluorocyclohepta-1,3,6-trien-1-yl)-N-methylethanimine |
| SMILES | C/N=C(\C)C1=C(F)C=CCC(F)=C1 |
| InChI | InChI=1S/C10H11F2N/c1-7(13-2)9-6-8(11)4-3-5-10(9)12/h3,5-6H,4H2,1-2H3/b13-7+ |
| InChIKey | QQCSRTJIURVZHF-NTUHNPAUSA-N |
| XLogP | 3.11 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.20 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|