C14H16N5O2+ — CID 123527449
[(2R)-1-[6-(furan-2-yl)-7H-purin-9-ium-2-yl]pyrrolidin-2-yl]methanol (PubChem CID 123527449) has the molecular formula C14H16N5O2+ and a molecular weight of 286.31 g/mol. Its IUPAC name is [(2R)-1-[6-(furan-2-yl)-7H-purin-9-ium-2-yl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2R)-1-[6-(furan-2-yl)-7H-purin-9-ium-2-yl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 123527449 |
| Molecular Formula | C14H16N5O2+ |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | [(2R)-1-[6-(furan-2-yl)-7H-purin-9-ium-2-yl]pyrrolidin-2-yl]methanol |
| SMILES | OC[C@H]1CCCN1c1nc(-c2ccco2)c2[nH]c[nH+]c2n1 |
| InChI | InChI=1S/C14H15N5O2/c20-7-9-3-1-5-19(9)14-17-11(10-4-2-6-21-10)12-13(18-14)16-8-15-12/h2,4,6,8-9,20H,1,3,5,7H2,(H,15,16,17,18)/p+1/t9-/m1/s1 |
| InChIKey | XDKHXKXEVNAPBG-SECBINFHSA-O |
| XLogP | 0.99 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |