C42H60FN5O6Si2 — CID 123528135
ethyl 7-[bis(2-trimethylsilylethoxymethyl)amino]-5-[4-(2-ethoxy-1-fluoro-2-oxoethyl)cyclohexyl]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 123528135) has the molecular formula C42H60FN5O6Si2 and a molecular weight of 806.14 g/mol. Its IUPAC name is ethyl 7-[bis(2-trimethylsilylethoxymethyl)amino]-5-[4-(2-ethoxy-1-fluoro-2-oxoethyl)cyclohexyl]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 7-[bis(2-trimethylsilylethoxymethyl)amino]-5-[4-(2-ethoxy-1-fluoro-2-oxoethyl)cyclohexyl]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 123528135 |
| Molecular Formula | C42H60FN5O6Si2 |
| Molecular Weight | 806.14 g/mol |
| Exact Mass | 805.41 |
| IUPAC Name | ethyl 7-[bis(2-trimethylsilylethoxymethyl)amino]-5-[4-(2-ethoxy-1-fluoro-2-oxoethyl)cyclohexyl]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1c(C2CCC(C(F)C(=O)OCC)CC2)nc2c(-c3ccc(-c4ccccc4)nc3)cnn2c1N(COCC[Si](C)(C)C)COCC[Si](C)(C)C |
| InChI | InChI=1S/C42H60FN5O6Si2/c1-9-53-41(49)36-38(32-18-16-31(17-19-32)37(43)42(50)54-10-2)46-39-34(33-20-21-35(44-26-33)30-14-12-11-13-15-30)27-45-48(39)40(36)47(28-51-22-24-55(3,4)5)29-52-23-25-56(6,7)8/h11-15,20-21,26-27,31-32,37H,9-10,16-19,22-25,28-29H2,1-8H3 |
| InChIKey | BSOMGRDJEHXJTO-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 117.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.14 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|