C26H34O6 — CID 123528312
5-[(2E)-henicosa-2,6,9,12,15,18-hexaenoyl]oxy-4,5-dioxopentanoic acid (PubChem CID 123528312) has the molecular formula C26H34O6 and a molecular weight of 442.55 g/mol. Its IUPAC name is 5-[(2E)-henicosa-2,6,9,12,15,18-hexaenoyl]oxy-4,5-dioxopentanoic acid.
| Compound Name | 5-[(2E)-henicosa-2,6,9,12,15,18-hexaenoyl]oxy-4,5-dioxopentanoic acid |
|---|---|
| PubChem CID | 123528312 |
| Molecular Formula | C26H34O6 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 5-[(2E)-henicosa-2,6,9,12,15,18-hexaenoyl]oxy-4,5-dioxopentanoic acid |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC/C=C/C(=O)OC(=O)C(=O)CCC(=O)O |
| InChI | InChI=1S/C26H34O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25(30)32-26(31)23(27)21-22-24(28)29/h3-4,6-7,9-10,12-13,15-16,19-20H,2,5,8,11,14,17-18,21-22H2,1H3,(H,28,29)/b4-3?,7-6?,10-9?,13-12?,16-15?,20-19+ |
| InChIKey | YRZBBBBWKKLZFL-WGHDAIOOSA-N |
| XLogP | 5.58 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|