C20H19NO3 — CID 123529536
6-ethyl-3-hydroxy-2-[(4-phenylanilino)methyl]pyran-4-one (PubChem CID 123529536) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 6-ethyl-3-hydroxy-2-[(4-phenylanilino)methyl]pyran-4-one.
| Compound Name | 6-ethyl-3-hydroxy-2-[(4-phenylanilino)methyl]pyran-4-one |
|---|---|
| PubChem CID | 123529536 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 6-ethyl-3-hydroxy-2-[(4-phenylanilino)methyl]pyran-4-one |
| SMILES | CCc1cc(=O)c(O)c(CNc2ccc(-c3ccccc3)cc2)o1 |
| InChI | InChI=1S/C20H19NO3/c1-2-17-12-18(22)20(23)19(24-17)13-21-16-10-8-15(9-11-16)14-6-4-3-5-7-14/h3-12,21,23H,2,13H2,1H3 |
| InChIKey | CTOXUFRSODEHLS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |