C19H27N — CID 123529640
2,5,5-trimethyl-4-naphthalen-2-ylhexan-2-amine (PubChem CID 123529640) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is 2,5,5-trimethyl-4-naphthalen-2-ylhexan-2-amine.
| Compound Name | 2,5,5-trimethyl-4-naphthalen-2-ylhexan-2-amine |
|---|---|
| PubChem CID | 123529640 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 2,5,5-trimethyl-4-naphthalen-2-ylhexan-2-amine |
| SMILES | CC(C)(N)CC(c1ccc2ccccc2c1)C(C)(C)C |
| InChI | InChI=1S/C19H27N/c1-18(2,3)17(13-19(4,5)20)16-11-10-14-8-6-7-9-15(14)12-16/h6-12,17H,13,20H2,1-5H3 |
| InChIKey | MUMFXDBOWZBSGT-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |