C10H12N2 — CID 123531371
2-ethyl-2,3-dihydroquinoxaline (PubChem CID 123531371) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 2-ethyl-2,3-dihydroquinoxaline.
| Compound Name | 2-ethyl-2,3-dihydroquinoxaline |
|---|---|
| PubChem CID | 123531371 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 2-ethyl-2,3-dihydroquinoxaline |
| SMILES | CCC1CN=c2ccccc2=N1 |
| InChI | InChI=1S/C10H12N2/c1-2-8-7-11-9-5-3-4-6-10(9)12-8/h3-6,8H,2,7H2,1H3 |
| InChIKey | MZHPCGNMOMHSKB-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |