C13H18N2 — CID 21014290
2-butyl-3-methyl-4a,8a-dihydroquinoxaline (PubChem CID 21014290) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-butyl-3-methyl-4a,8a-dihydroquinoxaline.
| Compound Name | 2-butyl-3-methyl-4a,8a-dihydroquinoxaline |
|---|---|
| PubChem CID | 21014290 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 2-butyl-3-methyl-4a,8a-dihydroquinoxaline |
| SMILES | CCCCC1=NC2C=CC=CC2N=C1C |
| InChI | InChI=1S/C13H18N2/c1-3-4-7-11-10(2)14-12-8-5-6-9-13(12)15-11/h5-6,8-9,12-13H,3-4,7H2,1-2H3 |
| InChIKey | SWHVNHTZXOREHQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |