C14H19N — CID 91281706
3-methyl-N-(5-methylcyclohexa-2,4-dien-1-yl)cyclohex-2-en-1-imine (PubChem CID 91281706) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 3-methyl-N-(5-methylcyclohexa-2,4-dien-1-yl)cyclohex-2-en-1-imine.
| Compound Name | 3-methyl-N-(5-methylcyclohexa-2,4-dien-1-yl)cyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 91281706 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 3-methyl-N-(5-methylcyclohexa-2,4-dien-1-yl)cyclohex-2-en-1-imine |
| SMILES | CC1=C/C(=N\C2C=CC=C(C)C2)CCC1 |
| InChI | InChI=1S/C14H19N/c1-11-5-3-7-13(9-11)15-14-8-4-6-12(2)10-14/h3,5,7,10,13H,4,6,8-9H2,1-2H3/b15-14- |
| InChIKey | WVVFGNHAIJOSLR-PFONDFGASA-N |
| XLogP | 3.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|