C14H20N2O — CID 123532404
N-[3-(2,3-dihydro-1,3-benzoxazol-6-yl)prop-2-enyl]-2-methylpropan-1-amine (PubChem CID 123532404) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is N-[3-(2,3-dihydro-1,3-benzoxazol-6-yl)prop-2-enyl]-2-methylpropan-1-amine.
| Compound Name | N-[3-(2,3-dihydro-1,3-benzoxazol-6-yl)prop-2-enyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 123532404 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | N-[3-(2,3-dihydro-1,3-benzoxazol-6-yl)prop-2-enyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCC=Cc1ccc2c(c1)OCN2 |
| InChI | InChI=1S/C14H20N2O/c1-11(2)9-15-7-3-4-12-5-6-13-14(8-12)17-10-16-13/h3-6,8,11,15-16H,7,9-10H2,1-2H3 |
| InChIKey | NBGOOHCROZCEQG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|