C11H16ClNS — CID 79426690
N-[3-(4-chlorothiophen-2-yl)prop-2-enyl]-2-methylpropan-1-amine (PubChem CID 79426690) has the molecular formula C11H16ClNS and a molecular weight of 229.78 g/mol. Its IUPAC name is N-[3-(4-chlorothiophen-2-yl)prop-2-enyl]-2-methylpropan-1-amine.
| Compound Name | N-[3-(4-chlorothiophen-2-yl)prop-2-enyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 79426690 |
| Molecular Formula | C11H16ClNS |
| Molecular Weight | 229.78 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | N-[3-(4-chlorothiophen-2-yl)prop-2-enyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCC=Cc1cc(Cl)cs1 |
| InChI | InChI=1S/C11H16ClNS/c1-9(2)7-13-5-3-4-11-6-10(12)8-14-11/h3-4,6,8-9,13H,5,7H2,1-2H3 |
| InChIKey | KWXAMKVIWKCTBT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.78 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|