C19H29NO4 — CID 123532457
1-hydroxypropan-2-yl 2-benzamido-3,5-dimethylheptanoate (PubChem CID 123532457) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is 1-hydroxypropan-2-yl 2-benzamido-3,5-dimethylheptanoate.
| Compound Name | 1-hydroxypropan-2-yl 2-benzamido-3,5-dimethylheptanoate |
|---|---|
| PubChem CID | 123532457 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 1-hydroxypropan-2-yl 2-benzamido-3,5-dimethylheptanoate |
| SMILES | CCC(C)CC(C)C(NC(=O)c1ccccc1)C(=O)OC(C)CO |
| InChI | InChI=1S/C19H29NO4/c1-5-13(2)11-14(3)17(19(23)24-15(4)12-21)20-18(22)16-9-7-6-8-10-16/h6-10,13-15,17,21H,5,11-12H2,1-4H3,(H,20,22) |
| InChIKey | HRUCYYGNYNACIC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |