C11H13NO2 — CID 123533274
5-(1-methylpyrrol-3-yl)cyclohexane-1,3-dione (PubChem CID 123533274) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 5-(1-methylpyrrol-3-yl)cyclohexane-1,3-dione.
| Compound Name | 5-(1-methylpyrrol-3-yl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 123533274 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 5-(1-methylpyrrol-3-yl)cyclohexane-1,3-dione |
| SMILES | Cn1ccc(C2CC(=O)CC(=O)C2)c1 |
| InChI | InChI=1S/C11H13NO2/c1-12-3-2-8(7-12)9-4-10(13)6-11(14)5-9/h2-3,7,9H,4-6H2,1H3 |
| InChIKey | FMFBIAXDXDNETC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|