C15H33NO2 — CID 123534203
2-[3-(2,2-dimethylpropoxy)-3-methylpentoxy]butan-2-amine (PubChem CID 123534203) has the molecular formula C15H33NO2 and a molecular weight of 259.43 g/mol. Its IUPAC name is 2-[3-(2,2-dimethylpropoxy)-3-methylpentoxy]butan-2-amine.
| Compound Name | 2-[3-(2,2-dimethylpropoxy)-3-methylpentoxy]butan-2-amine |
|---|---|
| PubChem CID | 123534203 |
| Molecular Formula | C15H33NO2 |
| Molecular Weight | 259.43 g/mol |
| Exact Mass | 259.25 |
| IUPAC Name | 2-[3-(2,2-dimethylpropoxy)-3-methylpentoxy]butan-2-amine |
| SMILES | CCC(C)(N)OCCC(C)(CC)OCC(C)(C)C |
| InChI | InChI=1S/C15H33NO2/c1-8-14(6,18-12-13(3,4)5)10-11-17-15(7,16)9-2/h8-12,16H2,1-7H3 |
| InChIKey | LKYHYSOMUQOENS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|