C15H30N2 — CID 123534283
N,4,5,6-tetramethyl-N-propyloct-4-enimidamide (PubChem CID 123534283) has the molecular formula C15H30N2 and a molecular weight of 238.42 g/mol. Its IUPAC name is N,4,5,6-tetramethyl-N-propyloct-4-enimidamide.
| Compound Name | N,4,5,6-tetramethyl-N-propyloct-4-enimidamide |
|---|---|
| PubChem CID | 123534283 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | N,4,5,6-tetramethyl-N-propyloct-4-enimidamide |
| SMILES | [H]/N=C(/CCC(C)=C(C)C(C)CC)N(C)CCC |
| InChI | InChI=1S/C15H30N2/c1-7-11-17(6)15(16)10-9-13(4)14(5)12(3)8-2/h12,16H,7-11H2,1-6H3/b14-13?,16-15- |
| InChIKey | PTFCVXRWRUWATG-IVUOBRSISA-N |
| XLogP | 4.47 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|