C10H18N2 — CID 142050922
1-[(5Z)-5-methyl-3,4,7,8-tetrahydro-2H-azocin-1-yl]ethanimine (PubChem CID 142050922) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 1-[(5Z)-5-methyl-3,4,7,8-tetrahydro-2H-azocin-1-yl]ethanimine.
| Compound Name | 1-[(5Z)-5-methyl-3,4,7,8-tetrahydro-2H-azocin-1-yl]ethanimine |
|---|---|
| PubChem CID | 142050922 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 1-[(5Z)-5-methyl-3,4,7,8-tetrahydro-2H-azocin-1-yl]ethanimine |
| SMILES | [H]/N=C(\C)N1CC/C=C(/C)CCC1 |
| InChI | InChI=1S/C10H18N2/c1-9-5-3-7-12(10(2)11)8-4-6-9/h5,11H,3-4,6-8H2,1-2H3/b9-5-,11-10+ |
| InChIKey | SBFFTSCACHBYEQ-CLYWSLGHSA-N |
| XLogP | 2.42 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|