C16H30N2 — CID 142132141
N-(2-cyclohexa-1,3-dien-1-ylethyl)-N-methylethanimidamide;ethane;prop-1-ene (PubChem CID 142132141) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is N-(2-cyclohexa-1,3-dien-1-ylethyl)-N-methylethanimidamide;ethane;prop-1-ene.
| Compound Name | N-(2-cyclohexa-1,3-dien-1-ylethyl)-N-methylethanimidamide;ethane;prop-1-ene |
|---|---|
| PubChem CID | 142132141 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | N-(2-cyclohexa-1,3-dien-1-ylethyl)-N-methylethanimidamide;ethane;prop-1-ene |
| SMILES | C=CC.CC.[H]/N=C(\C)N(C)CCC1=CC=CCC1 |
| InChI | InChI=1S/C11H18N2.C3H6.C2H6/c1-10(12)13(2)9-8-11-6-4-3-5-7-11;1-3-2;1-2/h3-4,6,12H,5,7-9H2,1-2H3;3H,1H2,2H3;1-2H3/b12-10+;; |
| InChIKey | HHVUJNPJDFHQKG-PFNYCKIMSA-N |
| XLogP | 4.80 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|