C14H15FN2O2 — CID 123535754
tert-butyl 5-fluoro-6-isocyano-1,3-dihydroisoindole-2-carboxylate (PubChem CID 123535754) has the molecular formula C14H15FN2O2 and a molecular weight of 262.28 g/mol. Its IUPAC name is tert-butyl 5-fluoro-6-isocyano-1,3-dihydroisoindole-2-carboxylate.
| Compound Name | tert-butyl 5-fluoro-6-isocyano-1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 123535754 |
| Molecular Formula | C14H15FN2O2 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | tert-butyl 5-fluoro-6-isocyano-1,3-dihydroisoindole-2-carboxylate |
| SMILES | [C-]#[N+]c1cc2c(cc1F)CN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C14H15FN2O2/c1-14(2,3)19-13(18)17-7-9-5-11(15)12(16-4)6-10(9)8-17/h5-6H,7-8H2,1-3H3 |
| InChIKey | FEWXEXDFECVGRM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 33.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|