C18H18ClFN2O2 — CID 146279491
tert-butyl 5-(2-chloro-4-fluoro-3-pyridinyl)-1,3-dihydroisoindole-2-carboxylate (PubChem CID 146279491) has the molecular formula C18H18ClFN2O2 and a molecular weight of 348.81 g/mol. Its IUPAC name is tert-butyl 5-(2-chloro-4-fluoro-3-pyridinyl)-1,3-dihydroisoindole-2-carboxylate.
| Compound Name | tert-butyl 5-(2-chloro-4-fluoro-3-pyridinyl)-1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 146279491 |
| Molecular Formula | C18H18ClFN2O2 |
| Molecular Weight | 348.81 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | tert-butyl 5-(2-chloro-4-fluoro-3-pyridinyl)-1,3-dihydroisoindole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1Cc2ccc(-c3c(F)ccnc3Cl)cc2C1 |
| InChI | InChI=1S/C18H18ClFN2O2/c1-18(2,3)24-17(23)22-9-12-5-4-11(8-13(12)10-22)15-14(20)6-7-21-16(15)19/h4-8H,9-10H2,1-3H3 |
| InChIKey | ICGSOAOUDNGSBT-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.81 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|