C14H28O3 — CID 123536516
2-but-1-enyl-2,4-dimethyl-4-propylpentane-1,3,5-triol (PubChem CID 123536516) has the molecular formula C14H28O3 and a molecular weight of 244.37 g/mol. Its IUPAC name is 2-but-1-enyl-2,4-dimethyl-4-propylpentane-1,3,5-triol.
| Compound Name | 2-but-1-enyl-2,4-dimethyl-4-propylpentane-1,3,5-triol |
|---|---|
| PubChem CID | 123536516 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 2-but-1-enyl-2,4-dimethyl-4-propylpentane-1,3,5-triol |
| SMILES | CCC=CC(C)(CO)C(O)C(C)(CO)CCC |
| InChI | InChI=1S/C14H28O3/c1-5-7-9-14(4,11-16)12(17)13(3,10-15)8-6-2/h7,9,12,15-17H,5-6,8,10-11H2,1-4H3 |
| InChIKey | DFURVNKMKRFIOO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|