C8H12N2O — CID 123536896
2-ethenylimino-N,N-dimethylbut-3-enamide (PubChem CID 123536896) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is 2-ethenylimino-N,N-dimethylbut-3-enamide.
| Compound Name | 2-ethenylimino-N,N-dimethylbut-3-enamide |
|---|---|
| PubChem CID | 123536896 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 2-ethenylimino-N,N-dimethylbut-3-enamide |
| SMILES | C=C/N=C(\C=C)C(=O)N(C)C |
| InChI | InChI=1S/C8H12N2O/c1-5-7(9-6-2)8(11)10(3)4/h5-6H,1-2H2,3-4H3/b9-7+ |
| InChIKey | GPULWDCOXXBGDL-VQHVLOKHSA-N |
| XLogP | 0.85 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|