C9H16N2 — CID 123537731
3-N-ethylidene-4-methylhex-2-ene-1,3-diimine (PubChem CID 123537731) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 3-N-ethylidene-4-methylhex-2-ene-1,3-diimine.
| Compound Name | 3-N-ethylidene-4-methylhex-2-ene-1,3-diimine |
|---|---|
| PubChem CID | 123537731 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 3-N-ethylidene-4-methylhex-2-ene-1,3-diimine |
| SMILES | [H]/N=C/C=C(/N=C/C)C(C)CC |
| InChI | InChI=1S/C9H16N2/c1-4-8(3)9(6-7-10)11-5-2/h5-8,10H,4H2,1-3H3/b9-6?,10-7+,11-5+ |
| InChIKey | OJFZTRWVIQJOAN-FPIZADIQSA-N |
| XLogP | 2.66 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|