C13H11ClF2N2S — CID 123538480
2-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)-1,2-thiazolidine (PubChem CID 123538480) has the molecular formula C13H11ClF2N2S and a molecular weight of 300.76 g/mol. Its IUPAC name is 2-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)-1,2-thiazolidine.
| Compound Name | 2-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)-1,2-thiazolidine |
|---|---|
| PubChem CID | 123538480 |
| Molecular Formula | C13H11ClF2N2S |
| Molecular Weight | 300.76 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 2-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)-1,2-thiazolidine |
| SMILES | Cc1c(N2CCCS2)nc2cc(F)cc(F)c2c1Cl |
| InChI | InChI=1S/C13H11ClF2N2S/c1-7-12(14)11-9(16)5-8(15)6-10(11)17-13(7)18-3-2-4-19-18/h5-6H,2-4H2,1H3 |
| InChIKey | JNOWPTJTQCMGAO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.76 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|