C18H14ClF2N — CID 91215685
4-chloro-2-(4-ethylphenyl)-5,7-difluoro-3-methylquinoline (PubChem CID 91215685) has the molecular formula C18H14ClF2N and a molecular weight of 317.77 g/mol. Its IUPAC name is 4-chloro-2-(4-ethylphenyl)-5,7-difluoro-3-methylquinoline.
| Compound Name | 4-chloro-2-(4-ethylphenyl)-5,7-difluoro-3-methylquinoline |
|---|---|
| PubChem CID | 91215685 |
| Molecular Formula | C18H14ClF2N |
| Molecular Weight | 317.77 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 4-chloro-2-(4-ethylphenyl)-5,7-difluoro-3-methylquinoline |
| SMILES | CCc1ccc(-c2nc3cc(F)cc(F)c3c(Cl)c2C)cc1 |
| InChI | InChI=1S/C18H14ClF2N/c1-3-11-4-6-12(7-5-11)18-10(2)17(19)16-14(21)8-13(20)9-15(16)22-18/h4-9H,3H2,1-2H3 |
| InChIKey | GTHICPZLAGOHCY-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.77 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |