C29H18Cl3F4N3 — CID 158252434
4-chloro-5,7-difluoro-3-methyl-2-(1-methylindol-4-yl)quinoline;2,4-dichloro-5,7-difluoro-3-methylquinoline (PubChem CID 158252434) has the molecular formula C29H18Cl3F4N3 and a molecular weight of 590.84 g/mol. Its IUPAC name is 4-chloro-5,7-difluoro-3-methyl-2-(1-methylindol-4-yl)quinoline;2,4-dichloro-5,7-difluoro-3-methylquinoline.
| Compound Name | 4-chloro-5,7-difluoro-3-methyl-2-(1-methylindol-4-yl)quinoline;2,4-dichloro-5,7-difluoro-3-methylquinoline |
|---|---|
| PubChem CID | 158252434 |
| Molecular Formula | C29H18Cl3F4N3 |
| Molecular Weight | 590.84 g/mol |
| Exact Mass | 589.05 |
| IUPAC Name | 4-chloro-5,7-difluoro-3-methyl-2-(1-methylindol-4-yl)quinoline;2,4-dichloro-5,7-difluoro-3-methylquinoline |
| SMILES | Cc1c(-c2cccc3c2ccn3C)nc2cc(F)cc(F)c2c1Cl.Cc1c(Cl)nc2cc(F)cc(F)c2c1Cl |
| InChI | InChI=1S/C19H13ClF2N2.C10H5Cl2F2N/c1-10-18(20)17-14(22)8-11(21)9-15(17)23-19(10)13-4-3-5-16-12(13)6-7-24(16)2;1-4-9(11)8-6(14)2-5(13)3-7(8)15-10(4)12/h3-9H,1-2H3;2-3H,1H3 |
| InChIKey | GGWNBNJUOWDKFA-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.84 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|