C19H25ClN4 — CID 144940962
5-chloro-4-(1-methylindol-4-yl)pyrimidin-2-amine;hexane (PubChem CID 144940962) has the molecular formula C19H25ClN4 and a molecular weight of 344.89 g/mol. Its IUPAC name is 5-chloro-4-(1-methylindol-4-yl)pyrimidin-2-amine;hexane.
| Compound Name | 5-chloro-4-(1-methylindol-4-yl)pyrimidin-2-amine;hexane |
|---|---|
| PubChem CID | 144940962 |
| Molecular Formula | C19H25ClN4 |
| Molecular Weight | 344.89 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 5-chloro-4-(1-methylindol-4-yl)pyrimidin-2-amine;hexane |
| SMILES | CCCCCC.Cn1ccc2c(-c3nc(N)ncc3Cl)cccc21 |
| InChI | InChI=1S/C13H11ClN4.C6H14/c1-18-6-5-8-9(3-2-4-11(8)18)12-10(14)7-16-13(15)17-12;1-3-5-6-4-2/h2-7H,1H3,(H2,15,16,17);3-6H2,1-2H3 |
| InChIKey | NVCANWURTSVVRB-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.89 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|