C28H34N4O3S — CID 123540451
(1S,7S)-4-[[(1R,2R)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5-dien-8-one (PubChem CID 123540451) has the molecular formula C28H34N4O3S and a molecular weight of 506.67 g/mol. Its IUPAC name is (1S,7S)-4-[[(1R,2R)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5-dien-8-one.
| Compound Name | (1S,7S)-4-[[(1R,2R)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5-dien-8-one |
|---|---|
| PubChem CID | 123540451 |
| Molecular Formula | C28H34N4O3S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | (1S,7S)-4-[[(1R,2R)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5-dien-8-one |
| SMILES | O=C1C[C@@H]2C[C@H]1c1c2c(O)n(C[C@@H]2CCCC[C@H]2CN2CCN(c3nsc4ccccc34)CC2)c1O |
| InChI | InChI=1S/C28H34N4O3S/c33-22-14-19-13-21(22)25-24(19)27(34)32(28(25)35)16-18-6-2-1-5-17(18)15-30-9-11-31(12-10-30)26-20-7-3-4-8-23(20)36-29-26/h3-4,7-8,17-19,21,34-35H,1-2,5-6,9-16H2/t17-,18-,19-,21+/m0/s1 |
| InChIKey | UPCCHGSQHPBRIX-VNYTWHDVSA-N |
| XLogP | 4.68 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |