C29H38N4O4S — CID 123168844
(1S,7S)-4-[[(1R,2R)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-8-(hydroxymethyl)-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,8-triol (PubChem CID 123168844) has the molecular formula C29H38N4O4S and a molecular weight of 538.71 g/mol. Its IUPAC name is (1S,7S)-4-[[(1R,2R)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-8-(hydroxymethyl)-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,8-triol.
| Compound Name | (1S,7S)-4-[[(1R,2R)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-8-(hydroxymethyl)-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,8-triol |
|---|---|
| PubChem CID | 123168844 |
| Molecular Formula | C29H38N4O4S |
| Molecular Weight | 538.71 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | (1S,7S)-4-[[(1R,2R)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-8-(hydroxymethyl)-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,8-triol |
| SMILES | OCC1(O)C[C@@H]2C[C@H]1c1c2c(O)n(C[C@@H]2CCCC[C@H]2CN2CCN(c3nsc4ccccc34)CC2)c1O |
| InChI | InChI=1S/C29H38N4O4S/c34-17-29(37)14-20-13-22(29)25-24(20)27(35)33(28(25)36)16-19-6-2-1-5-18(19)15-31-9-11-32(12-10-31)26-21-7-3-4-8-23(21)38-30-26/h3-4,7-8,18-20,22,34-37H,1-2,5-6,9-17H2/t18-,19-,20-,22-,29?/m0/s1 |
| InChIKey | OMSXUGANJZFBFS-XDQLNTFUSA-N |
| XLogP | 3.84 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.71 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |