C30H40N4O3S — CID 68662185
(1S,2R,6S,7S,8R)-4-[[(1R,2R)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-8-ethyl-8-hydroxy-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 68662185) has the molecular formula C30H40N4O3S and a molecular weight of 536.74 g/mol. Its IUPAC name is (1S,2R,6S,7S,8R)-4-[[(1R,2R)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-8-ethyl-8-hydroxy-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,2R,6S,7S,8R)-4-[[(1R,2R)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-8-ethyl-8-hydroxy-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 68662185 |
| Molecular Formula | C30H40N4O3S |
| Molecular Weight | 536.74 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | (1S,2R,6S,7S,8R)-4-[[(1R,2R)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-8-ethyl-8-hydroxy-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CC[C@@]1(O)C[C@@H]2C[C@H]1[C@@H]1C(=O)N(C[C@@H]3CCCC[C@H]3CN3CCN(c4nsc5ccccc45)CC3)C(=O)[C@H]21 |
| InChI | InChI=1S/C30H40N4O3S/c1-2-30(37)16-21-15-23(30)26-25(21)28(35)34(29(26)36)18-20-8-4-3-7-19(20)17-32-11-13-33(14-12-32)27-22-9-5-6-10-24(22)38-31-27/h5-6,9-10,19-21,23,25-26,37H,2-4,7-8,11-18H2,1H3/t19-,20-,21-,23-,25+,26-,30+/m0/s1 |
| InChIKey | QZGZNAJARDWDBY-JGNMRRBZSA-N |
| XLogP | 4.01 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.74 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|