C29H38N4O4S — CID 58279948
(1S,2R,6S,7R)-4-[[(1R,2R)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-8-hydroxy-8-(hydroxymethyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 58279948) has the molecular formula C29H38N4O4S and a molecular weight of 538.71 g/mol. Its IUPAC name is (1S,2R,6S,7R)-4-[[(1R,2R)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-8-hydroxy-8-(hydroxymethyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,2R,6S,7R)-4-[[(1R,2R)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-8-hydroxy-8-(hydroxymethyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 58279948 |
| Molecular Formula | C29H38N4O4S |
| Molecular Weight | 538.71 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | (1S,2R,6S,7R)-4-[[(1R,2R)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-8-hydroxy-8-(hydroxymethyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H]3C[C@H]([C@@H]2C(=O)N1C[C@@H]1CCCC[C@H]1CN1CCN(c2nsc4ccccc24)CC1)C(O)(CO)C3 |
| InChI | InChI=1S/C29H38N4O4S/c34-17-29(37)14-20-13-22(29)25-24(20)27(35)33(28(25)36)16-19-6-2-1-5-18(19)15-31-9-11-32(12-10-31)26-21-7-3-4-8-23(21)38-30-26/h3-4,7-8,18-20,22,24-25,34,37H,1-2,5-6,9-17H2/t18-,19-,20-,22+,24+,25-,29?/m0/s1 |
| InChIKey | LXEBNCUCGOQXIR-IUAWFQRRSA-N |
| XLogP | 2.59 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.71 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|