C26H25F3N6O3S — CID 123540645
(2Z)-N-[2-[4,6-difluoro-1-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]indol-3-yl]sulfonylethyl]-2-(methylidenehydrazinylidene)butanamide (PubChem CID 123540645) has the molecular formula C26H25F3N6O3S and a molecular weight of 558.59 g/mol. Its IUPAC name is (2Z)-N-[2-[4,6-difluoro-1-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]indol-3-yl]sulfonylethyl]-2-(methylidenehydrazinylidene)butanamide.
| Compound Name | (2Z)-N-[2-[4,6-difluoro-1-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]indol-3-yl]sulfonylethyl]-2-(methylidenehydrazinylidene)butanamide |
|---|---|
| PubChem CID | 123540645 |
| Molecular Formula | C26H25F3N6O3S |
| Molecular Weight | 558.59 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | (2Z)-N-[2-[4,6-difluoro-1-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]indol-3-yl]sulfonylethyl]-2-(methylidenehydrazinylidene)butanamide |
| SMILES | C=N/N=C(/CC)C(=O)NCCS(=O)(=O)c1cn(Cc2ccc(-c3cnn(C)c3)cc2F)c2cc(F)cc(F)c12 |
| InChI | InChI=1S/C26H25F3N6O3S/c1-4-22(33-30-2)26(36)31-7-8-39(37,38)24-15-35(23-11-19(27)10-21(29)25(23)24)14-17-6-5-16(9-20(17)28)18-12-32-34(3)13-18/h5-6,9-13,15H,2,4,7-8,14H2,1,3H3,(H,31,36)/b33-22- |
| InChIKey | ZBHYCWXUZUWYMN-NVMPUMLXSA-N |
| XLogP | 3.86 |
| TPSA | 110.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.59 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|