C16H29N3O3S — CID 123540921
2-(1-cyclohexylpropan-2-ylimino)-N-(1,1-dioxo-1,4-thiazinan-4-yl)propanamide (PubChem CID 123540921) has the molecular formula C16H29N3O3S and a molecular weight of 343.49 g/mol. Its IUPAC name is 2-(1-cyclohexylpropan-2-ylimino)-N-(1,1-dioxo-1,4-thiazinan-4-yl)propanamide.
| Compound Name | 2-(1-cyclohexylpropan-2-ylimino)-N-(1,1-dioxo-1,4-thiazinan-4-yl)propanamide |
|---|---|
| PubChem CID | 123540921 |
| Molecular Formula | C16H29N3O3S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 2-(1-cyclohexylpropan-2-ylimino)-N-(1,1-dioxo-1,4-thiazinan-4-yl)propanamide |
| SMILES | C/C(=N\C(C)CC1CCCCC1)C(=O)NN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C16H29N3O3S/c1-13(12-15-6-4-3-5-7-15)17-14(2)16(20)18-19-8-10-23(21,22)11-9-19/h13,15H,3-12H2,1-2H3,(H,18,20)/b17-14+ |
| InChIKey | OBZBVKJMLJHHDV-SAPNQHFASA-N |
| XLogP | 1.57 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|