C27H48N4O — CID 142123378
(2S)-3-cyclohexyl-2-[1-(3,3-dimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethylideneamino]-N-(1,4-dimethylpiperidin-4-yl)propanamide (PubChem CID 142123378) has the molecular formula C27H48N4O and a molecular weight of 444.71 g/mol. Its IUPAC name is (2S)-3-cyclohexyl-2-[1-(3,3-dimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethylideneamino]-N-(1,4-dimethylpiperidin-4-yl)propanamide.
| Compound Name | (2S)-3-cyclohexyl-2-[1-(3,3-dimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethylideneamino]-N-(1,4-dimethylpiperidin-4-yl)propanamide |
|---|---|
| PubChem CID | 142123378 |
| Molecular Formula | C27H48N4O |
| Molecular Weight | 444.71 g/mol |
| Exact Mass | 444.38 |
| IUPAC Name | (2S)-3-cyclohexyl-2-[1-(3,3-dimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethylideneamino]-N-(1,4-dimethylpiperidin-4-yl)propanamide |
| SMILES | C/C(=N\[C@@H](CC1CCCCC1)C(=O)NC1(C)CCN(C)CC1)N1CC2CC1CC(C)(C)C2 |
| InChI | InChI=1S/C27H48N4O/c1-20(31-19-22-15-23(31)18-26(2,3)17-22)28-24(16-21-9-7-6-8-10-21)25(32)29-27(4)11-13-30(5)14-12-27/h21-24H,6-19H2,1-5H3,(H,29,32)/b28-20+/t22?,23?,24-/m0/s1 |
| InChIKey | QYANKUWPIRKVBO-OHRLRXSDSA-N |
| XLogP | 4.85 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.71 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|