C12H25N3S — CID 123542772
1-N-methyl-4-N-(1-sulfanylpiperidin-4-yl)cyclohexane-1,4-diamine (PubChem CID 123542772) has the molecular formula C12H25N3S and a molecular weight of 243.42 g/mol. Its IUPAC name is 1-N-methyl-4-N-(1-sulfanylpiperidin-4-yl)cyclohexane-1,4-diamine.
| Compound Name | 1-N-methyl-4-N-(1-sulfanylpiperidin-4-yl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 123542772 |
| Molecular Formula | C12H25N3S |
| Molecular Weight | 243.42 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 1-N-methyl-4-N-(1-sulfanylpiperidin-4-yl)cyclohexane-1,4-diamine |
| SMILES | CNC1CCC(NC2CCN(S)CC2)CC1 |
| InChI | InChI=1S/C12H25N3S/c1-13-10-2-4-11(5-3-10)14-12-6-8-15(16)9-7-12/h10-14,16H,2-9H2,1H3 |
| InChIKey | PDHYAGHMFFTFRS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.42 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|