C8H20N2 — CID 156821685
N,1-dimethylazepan-4-amine;molecular hydrogen (PubChem CID 156821685) has the molecular formula C8H20N2 and a molecular weight of 144.26 g/mol. Its IUPAC name is N,1-dimethylazepan-4-amine;molecular hydrogen.
| Compound Name | N,1-dimethylazepan-4-amine;molecular hydrogen |
|---|---|
| PubChem CID | 156821685 |
| Molecular Formula | C8H20N2 |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.16 |
| IUPAC Name | N,1-dimethylazepan-4-amine;molecular hydrogen |
| SMILES | CNC1CCCN(C)CC1.[H][H] |
| InChI | InChI=1S/C8H18N2.H2/c1-9-8-4-3-6-10(2)7-5-8;/h8-9H,3-7H2,1-2H3;1H |
| InChIKey | BXIVVTZFEKYGKW-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |